C15H26O5Si — CID 58864889
(3aS,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylic acid (PubChem CID 58864889) has the molecular formula C15H26O5Si and a molecular weight of 314.45 g/mol. Its IUPAC name is (3aS,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylic acid.
| Compound Name | (3aS,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylic acid |
|---|---|
| PubChem CID | 58864889 |
| Molecular Formula | C15H26O5Si |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (3aS,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylic acid |
| SMILES | CC1O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C=C(C(=O)O)C[C@@H]2O1 |
| InChI | InChI=1S/C15H26O5Si/c1-9-18-11-7-10(14(16)17)8-12(13(11)19-9)20-21(5,6)15(2,3)4/h8-9,11-13H,7H2,1-6H3,(H,16,17)/t9?,11-,12-,13-/m0/s1 |
| InChIKey | SQVJIEAXKCFLRU-IPAOXHAUSA-N |
| XLogP | 2.92 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|