C21H31N7O2 — CID 58865396
methyl 2,4-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]quinoline-3-carboxylate (PubChem CID 58865396) has the molecular formula C21H31N7O2 and a molecular weight of 413.53 g/mol. Its IUPAC name is methyl 2,4-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]quinoline-3-carboxylate.
| Compound Name | methyl 2,4-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 58865396 |
| Molecular Formula | C21H31N7O2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | methyl 2,4-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]quinoline-3-carboxylate |
| SMILES | COC(=O)c1c(N2C[C@H](N)C[C@H](N)C2)nc2ccccc2c1N1C[C@H](N)C[C@H](N)C1 |
| InChI | InChI=1S/C21H31N7O2/c1-30-21(29)18-19(27-8-12(22)6-13(23)9-27)16-4-2-3-5-17(16)26-20(18)28-10-14(24)7-15(25)11-28/h2-5,12-15H,6-11,22-25H2,1H3/t12-,13+,14-,15+ |
| InChIKey | ZFBGJTWBZHIUEZ-NMWPEEMBSA-N |
| XLogP | -0.25 |
| TPSA | 149.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |