About methyl 2,4-bis(3,5-diaminopiperidin-1-yl)quinoline-3-carboxylate
methyl 2,4-bis(3,5-diaminopiperidin-1-yl)quinoline-3-carboxylate (PubChem CID 58865637) has the molecular formula C21H31N7O2
and a molecular weight of 413.53 g/mol. Its IUPAC name is methyl 2,4-bis(3,5-diaminopiperidin-1-yl)quinoline-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2,4-bis(3,5-diaminopiperidin-1-yl)quinoline-3-carboxylate |
| PubChem CID | 58865637 |
| Molecular Formula | C21H31N7O2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | methyl 2,4-bis(3,5-diaminopiperidin-1-yl)quinoline-3-carboxylate |
| SMILES | COC(=O)c1c(N2CC(N)CC(N)C2)nc2ccccc2c1N1CC(N)CC(N)C1 |
| InChI | InChI=1S/C21H31N7O2/c1-30-21(29)18-19(27-8-12(22)6-13(23)9-27)16-4-2-3-5-17(16)26-20(18)28-10-14(24)7-15(25)11-28/h2-5,12-15H,6-11,22-25H2,1H3 |
| InChIKey | ZFBGJTWBZHIUEZ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 149.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze methyl 2,4-bis(3,5-diaminopiperidin-1-yl)quinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,4-bis(3,5-diaminopiperidin-1-yl)quinoline-3-carboxylate?
The IUPAC name of methyl 2,4-bis(3,5-diaminopiperidin-1-yl)quinoline-3-carboxylate (CID 58865637) is methyl 2,4-bis(3,5-diaminopiperidin-1-yl)quinoline-3-carboxylate.
What is the SMILES notation for methyl 2,4-bis(3,5-diaminopiperidin-1-yl)quinoline-3-carboxylate?
The canonical SMILES for methyl 2,4-bis(3,5-diaminopiperidin-1-yl)quinoline-3-carboxylate is COC(=O)c1c(N2CC(N)CC(N)C2)nc2ccccc2c1N1CC(N)CC(N)C1.
What is the InChIKey of methyl 2,4-bis(3,5-diaminopiperidin-1-yl)quinoline-3-carboxylate?
The InChIKey is ZFBGJTWBZHIUEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31N7O2/c1-30-21(29)18-19(27-8-12(22)6-13(23)9-27)16-4-2-3-5-17(16)26-20(18)28-10-14(24)7-15(25)11-28/h2-5,12-15H,6-11,22-25H2,1H3.
What are the key properties of methyl 2,4-bis(3,5-diaminopiperidin-1-yl)quinoline-3-carboxylate?
methyl 2,4-bis(3,5-diaminopiperidin-1-yl)quinoline-3-carboxylate has a molecular weight of 413.53 g/mol, XLogP of -0.25, 3 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-bis(3,5-diaminopiperidin-1-yl)quinoline-3-carboxylate is sourced from PubChem (CID 58865637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).