C22H32N8 — CID 58865668
1-[4-[(4-cyclohexyl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]phenyl]-2-methylguanidine (PubChem CID 58865668) has the molecular formula C22H32N8 and a molecular weight of 408.55 g/mol. Its IUPAC name is 1-[4-[(4-cyclohexyl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]phenyl]-2-methylguanidine.
| Compound Name | 1-[4-[(4-cyclohexyl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]phenyl]-2-methylguanidine |
|---|---|
| PubChem CID | 58865668 |
| Molecular Formula | C22H32N8 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | 1-[4-[(4-cyclohexyl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]phenyl]-2-methylguanidine |
| SMILES | C/N=C(\N)Nc1ccc(Nc2nc(C3CCCCC3)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C22H32N8/c1-24-20(23)25-17-10-12-18(13-11-17)26-21-27-19(16-8-4-2-5-9-16)28-22(29-21)30-14-6-3-7-15-30/h10-13,16H,2-9,14-15H2,1H3,(H3,23,24,25)(H,26,27,28,29) |
| InChIKey | SDILSTCXPNCFBY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|