C20H29N9O2 — CID 58865720
N'-[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine (PubChem CID 58865720) has the molecular formula C20H29N9O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is N'-[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine.
| Compound Name | N'-[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 58865720 |
| Molecular Formula | C20H29N9O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | N'-[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCCNc2nc(N3CCCCC3)nc(N3CCCCC3)n2)nc1 |
| InChI | InChI=1S/C20H29N9O2/c30-29(31)16-7-8-17(23-15-16)21-9-10-22-18-24-19(27-11-3-1-4-12-27)26-20(25-18)28-13-5-2-6-14-28/h7-8,15H,1-6,9-14H2,(H,21,23)(H,22,24,25,26) |
| InChIKey | UYFSNJHZLGQGHT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 125.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|