C41H63N7O10 — CID 58865857
methyl 2,4-bis[3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]quinoline-3-carboxylate (PubChem CID 58865857) has the molecular formula C41H63N7O10 and a molecular weight of 813.99 g/mol. Its IUPAC name is methyl 2,4-bis[3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]quinoline-3-carboxylate.
| Compound Name | methyl 2,4-bis[3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 58865857 |
| Molecular Formula | C41H63N7O10 |
| Molecular Weight | 813.99 g/mol |
| Exact Mass | 813.46 |
| IUPAC Name | methyl 2,4-bis[3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]quinoline-3-carboxylate |
| SMILES | COC(=O)c1c(N2CC(NC(=O)OC(C)(C)C)CC(NC(=O)OC(C)(C)C)C2)nc2ccccc2c1N1CC(NC(=O)OC(C)(C)C)CC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C41H63N7O10/c1-38(2,3)55-34(50)42-24-18-25(43-35(51)56-39(4,5)6)21-47(20-24)31-28-16-14-15-17-29(28)46-32(30(31)33(49)54-13)48-22-26(44-36(52)57-40(7,8)9)19-27(23-48)45-37(53)58-41(10,11)12/h14-17,24-27H,18-23H2,1-13H3,(H,42,50)(H,43,51)(H,44,52)(H,45,53) |
| InChIKey | ZNKIPCAWYGJYSK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 198.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.99 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|