C26H32N6 — CID 58865899
N-[(2-phenylphenyl)methyl]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 58865899) has the molecular formula C26H32N6 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-[(2-phenylphenyl)methyl]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-[(2-phenylphenyl)methyl]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 58865899 |
| Molecular Formula | C26H32N6 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | N-[(2-phenylphenyl)methyl]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | c1ccc(-c2ccccc2CNc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C26H32N6/c1-4-12-21(13-5-1)23-15-7-6-14-22(23)20-27-24-28-25(31-16-8-2-9-17-31)30-26(29-24)32-18-10-3-11-19-32/h1,4-7,12-15H,2-3,8-11,16-20H2,(H,27,28,29,30) |
| InChIKey | YPJMEBXNYXICIR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |