About ethyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]methanimidate
ethyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]methanimidate (PubChem CID 58867875) has the molecular formula C22H17Cl2N3O4
and a molecular weight of 458.30 g/mol. Its IUPAC name is ethyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]methanimidate.
Molecular Properties
| Compound Name | ethyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]methanimidate |
| PubChem CID | 58867875 |
| Molecular Formula | C22H17Cl2N3O4 |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | ethyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]methanimidate |
| SMILES | CCO/C=N/c1ccc2oc3c(OC)ccc(C(=O)Nc4c(Cl)cncc4Cl)c3c2c1 |
| InChI | InChI=1S/C22H17Cl2N3O4/c1-3-30-11-26-12-4-6-17-14(8-12)19-13(5-7-18(29-2)21(19)31-17)22(28)27-20-15(23)9-25-10-16(20)24/h4-11H,3H2,1-2H3,(H,25,27,28)/b26-11+ |
| InChIKey | WZWGKCJXNYFOQL-KBKYJPHKSA-N |
| XLogP | 6.24 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]methanimidate?
The IUPAC name of ethyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]methanimidate (CID 58867875) is ethyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]methanimidate.
What is the SMILES notation for ethyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]methanimidate?
The canonical SMILES for ethyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]methanimidate is CCO/C=N/c1ccc2oc3c(OC)ccc(C(=O)Nc4c(Cl)cncc4Cl)c3c2c1.
What is the InChIKey of ethyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]methanimidate?
The InChIKey is WZWGKCJXNYFOQL-KBKYJPHKSA-N. The full InChI is InChI=1S/C22H17Cl2N3O4/c1-3-30-11-26-12-4-6-17-14(8-12)19-13(5-7-18(29-2)21(19)31-17)22(28)27-20-15(23)9-25-10-16(20)24/h4-11H,3H2,1-2H3,(H,25,27,28)/b26-11+.
What are the key properties of ethyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]methanimidate?
ethyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]methanimidate has a molecular weight of 458.30 g/mol, XLogP of 6.24, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[9-[(3,5-dichloro-4-pyridinyl)carbamoyl]-6-methoxydibenzofuran-2-yl]methanimidate is sourced from PubChem (CID 58867875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).