C19H34O5 — CID 58867897
(2S)-2-methyl-4-[(2R,13S)-2,8,13-trihydroxytetradecyl]-2H-furan-5-one (PubChem CID 58867897) has the molecular formula C19H34O5 and a molecular weight of 342.48 g/mol. Its IUPAC name is (2S)-2-methyl-4-[(2R,13S)-2,8,13-trihydroxytetradecyl]-2H-furan-5-one.
| Compound Name | (2S)-2-methyl-4-[(2R,13S)-2,8,13-trihydroxytetradecyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 58867897 |
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | (2S)-2-methyl-4-[(2R,13S)-2,8,13-trihydroxytetradecyl]-2H-furan-5-one |
| SMILES | C[C@H](O)CCCCC(O)CCCCC[C@@H](O)CC1=C[C@H](C)OC1=O |
| InChI | InChI=1S/C19H34O5/c1-14(20)8-6-7-10-17(21)9-4-3-5-11-18(22)13-16-12-15(2)24-19(16)23/h12,14-15,17-18,20-22H,3-11,13H2,1-2H3/t14-,15-,17?,18+/m0/s1 |
| InChIKey | NALOREGWVQPGRV-GQVHFNONSA-N |
| XLogP | 2.86 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|