C54H21F36N3 — CID 58868333
1-N,1-N,3-N,3-N,5-N,5-N-hexakis[3,5-bis(trifluoromethyl)phenyl]benzene-1,3,5-triamine (PubChem CID 58868333) has the molecular formula C54H21F36N3 and a molecular weight of 1395.71 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N,5-N,5-N-hexakis[3,5-bis(trifluoromethyl)phenyl]benzene-1,3,5-triamine.
| Compound Name | 1-N,1-N,3-N,3-N,5-N,5-N-hexakis[3,5-bis(trifluoromethyl)phenyl]benzene-1,3,5-triamine |
|---|---|
| PubChem CID | 58868333 |
| Molecular Formula | C54H21F36N3 |
| Molecular Weight | 1395.71 g/mol |
| Exact Mass | 1395.12 |
| IUPAC Name | 1-N,1-N,3-N,3-N,5-N,5-N-hexakis[3,5-bis(trifluoromethyl)phenyl]benzene-1,3,5-triamine |
| SMILES | FC(F)(F)c1cc(N(c2cc(N(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc(N(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C54H21F36N3/c55-43(56,57)22-1-23(44(58,59)60)8-34(7-22)91(35-9-24(45(61,62)63)2-25(10-35)46(64,65)66)40-19-41(92(36-11-26(47(67,68)69)3-27(12-36)48(70,71)72)37-13-28(49(73,74)75)4-29(14-37)50(76,77)78)21-42(20-40)93(38-15-30(51(79,80)81)5-31(16-38)52(82,83)84)39-17-32(53(85,86)87)6-33(18-39)54(88,89)90/h1-21H |
| InChIKey | ZEGFUFYAPSCXKN-UHFFFAOYSA-N |
| XLogP | 24.32 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 93 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1395.71 |
| LogP ≤ 5 | 24.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |