C18H14F6O8S2 — CID 58868343
5-[4-(1,2,2,3,3,4-hexafluoro-4-methylcyclobutyl)oxy-3-(trioxidanylsulfanyl)phenyl]-2-methoxybenzenesulfonic acid (PubChem CID 58868343) has the molecular formula C18H14F6O8S2 and a molecular weight of 536.42 g/mol. Its IUPAC name is 5-[4-(1,2,2,3,3,4-hexafluoro-4-methylcyclobutyl)oxy-3-(trioxidanylsulfanyl)phenyl]-2-methoxybenzenesulfonic acid.
| Compound Name | 5-[4-(1,2,2,3,3,4-hexafluoro-4-methylcyclobutyl)oxy-3-(trioxidanylsulfanyl)phenyl]-2-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 58868343 |
| Molecular Formula | C18H14F6O8S2 |
| Molecular Weight | 536.42 g/mol |
| Exact Mass | 536.00 |
| IUPAC Name | 5-[4-(1,2,2,3,3,4-hexafluoro-4-methylcyclobutyl)oxy-3-(trioxidanylsulfanyl)phenyl]-2-methoxybenzenesulfonic acid |
| SMILES | COc1ccc(-c2ccc(OC3(F)C(C)(F)C(F)(F)C3(F)F)c(SOOO)c2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C18H14F6O8S2/c1-15(19)16(20,21)17(22,23)18(15,24)30-11-5-3-9(7-13(11)33-32-31-25)10-4-6-12(29-2)14(8-10)34(26,27)28/h3-8,25H,1-2H3,(H,26,27,28) |
| InChIKey | BWLFEXAQXLMCHR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|