About (2E,4Z)-3-(2-propan-2-yloxypropan-2-yloxy)octa-2,4-diene
(2E,4Z)-3-(2-propan-2-yloxypropan-2-yloxy)octa-2,4-diene (PubChem CID 58868373) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is (2E,4Z)-3-(2-propan-2-yloxypropan-2-yloxy)octa-2,4-diene.
Molecular Properties
| Compound Name | (2E,4Z)-3-(2-propan-2-yloxypropan-2-yloxy)octa-2,4-diene |
| PubChem CID | 58868373 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | (2E,4Z)-3-(2-propan-2-yloxypropan-2-yloxy)octa-2,4-diene |
| SMILES | C/C=C(\C=C/CCC)OC(C)(C)OC(C)C |
| InChI | InChI=1S/C14H26O2/c1-7-9-10-11-13(8-2)16-14(5,6)15-12(3)4/h8,10-12H,7,9H2,1-6H3/b11-10-,13-8+ |
| InChIKey | JIAYMOAQZFOEBY-ANOMLPRKSA-N |
| XLogP | 4.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-3-(2-propan-2-yloxypropan-2-yloxy)octa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-3-(2-propan-2-yloxypropan-2-yloxy)octa-2,4-diene?
The IUPAC name of (2E,4Z)-3-(2-propan-2-yloxypropan-2-yloxy)octa-2,4-diene (CID 58868373) is (2E,4Z)-3-(2-propan-2-yloxypropan-2-yloxy)octa-2,4-diene.
What is the SMILES notation for (2E,4Z)-3-(2-propan-2-yloxypropan-2-yloxy)octa-2,4-diene?
The canonical SMILES for (2E,4Z)-3-(2-propan-2-yloxypropan-2-yloxy)octa-2,4-diene is C/C=C(\C=C/CCC)OC(C)(C)OC(C)C.
What is the InChIKey of (2E,4Z)-3-(2-propan-2-yloxypropan-2-yloxy)octa-2,4-diene?
The InChIKey is JIAYMOAQZFOEBY-ANOMLPRKSA-N. The full InChI is InChI=1S/C14H26O2/c1-7-9-10-11-13(8-2)16-14(5,6)15-12(3)4/h8,10-12H,7,9H2,1-6H3/b11-10-,13-8+.
What are the key properties of (2E,4Z)-3-(2-propan-2-yloxypropan-2-yloxy)octa-2,4-diene?
(2E,4Z)-3-(2-propan-2-yloxypropan-2-yloxy)octa-2,4-diene has a molecular weight of 226.36 g/mol, XLogP of 4.42, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-3-(2-propan-2-yloxypropan-2-yloxy)octa-2,4-diene is sourced from PubChem (CID 58868373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).