C11H11NO6 — CID 58868521
(4S)-4-[2-(4-nitrophenoxy)ethyl]-1,3-dioxolan-2-one (PubChem CID 58868521) has the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. Its IUPAC name is (4S)-4-[2-(4-nitrophenoxy)ethyl]-1,3-dioxolan-2-one.
| Compound Name | (4S)-4-[2-(4-nitrophenoxy)ethyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 58868521 |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | (4S)-4-[2-(4-nitrophenoxy)ethyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OC[C@H](CCOc2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C11H11NO6/c13-11-17-7-10(18-11)5-6-16-9-3-1-8(2-4-9)12(14)15/h1-4,10H,5-7H2/t10-/m0/s1 |
| InChIKey | XAGYFZCXGMUHHV-JTQLQIEISA-N |
| XLogP | 1.90 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|