C14H28S — CID 58868632
(Z)-1-(3,3-dimethylbutylsulfanyl)-2,4,4-trimethylpent-2-ene (PubChem CID 58868632) has the molecular formula C14H28S and a molecular weight of 228.44 g/mol. Its IUPAC name is (Z)-1-(3,3-dimethylbutylsulfanyl)-2,4,4-trimethylpent-2-ene.
| Compound Name | (Z)-1-(3,3-dimethylbutylsulfanyl)-2,4,4-trimethylpent-2-ene |
|---|---|
| PubChem CID | 58868632 |
| Molecular Formula | C14H28S |
| Molecular Weight | 228.44 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | (Z)-1-(3,3-dimethylbutylsulfanyl)-2,4,4-trimethylpent-2-ene |
| SMILES | C/C(=C/C(C)(C)C)CSCCC(C)(C)C |
| InChI | InChI=1S/C14H28S/c1-12(10-14(5,6)7)11-15-9-8-13(2,3)4/h10H,8-9,11H2,1-7H3/b12-10- |
| InChIKey | FBVRJVMJOMJJSN-BENRWUELSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|