C18H29N2O5P — CID 58868634
tert-butyl (2S,4R)-2-[(2-ethenyl-1-phosphanyloxycarbonylcyclopropyl)carbamoyl]-4-ethylpyrrolidine-1-carboxylate (PubChem CID 58868634) has the molecular formula C18H29N2O5P and a molecular weight of 384.41 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[(2-ethenyl-1-phosphanyloxycarbonylcyclopropyl)carbamoyl]-4-ethylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[(2-ethenyl-1-phosphanyloxycarbonylcyclopropyl)carbamoyl]-4-ethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58868634 |
| Molecular Formula | C18H29N2O5P |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | tert-butyl (2S,4R)-2-[(2-ethenyl-1-phosphanyloxycarbonylcyclopropyl)carbamoyl]-4-ethylpyrrolidine-1-carboxylate |
| SMILES | C=CC1CC1(NC(=O)[C@@H]1C[C@@H](CC)CN1C(=O)OC(C)(C)C)C(=O)OP |
| InChI | InChI=1S/C18H29N2O5P/c1-6-11-8-13(20(10-11)16(23)24-17(3,4)5)14(21)19-18(15(22)25-26)9-12(18)7-2/h7,11-13H,2,6,8-10,26H2,1,3-5H3,(H,19,21)/t11-,12?,13+,18?/m1/s1 |
| InChIKey | OUTVONAAGMLIGW-HPZFQONSSA-N |
| XLogP | 2.42 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|