About (2R)-2-(azidomethyl)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromene
(2R)-2-(azidomethyl)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromene (PubChem CID 58869127) has the molecular formula C16H14FN3O3S
and a molecular weight of 347.37 g/mol. Its IUPAC name is (2R)-2-(azidomethyl)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | (2R)-2-(azidomethyl)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromene |
| PubChem CID | 58869127 |
| Molecular Formula | C16H14FN3O3S |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | (2R)-2-(azidomethyl)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromene |
| SMILES | [N-]=[N+]=NC[C@H]1CCc2ccc(S(=O)(=O)c3cccc(F)c3)cc2O1 |
| InChI | InChI=1S/C16H14FN3O3S/c17-12-2-1-3-14(8-12)24(21,22)15-7-5-11-4-6-13(10-19-20-18)23-16(11)9-15/h1-3,5,7-9,13H,4,6,10H2/t13-/m1/s1 |
| InChIKey | NQYBACXPMIRWJU-CYBMUJFWSA-N |
| XLogP | 3.66 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(azidomethyl)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(azidomethyl)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromene?
The IUPAC name of (2R)-2-(azidomethyl)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromene (CID 58869127) is (2R)-2-(azidomethyl)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromene.
What is the SMILES notation for (2R)-2-(azidomethyl)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromene?
The canonical SMILES for (2R)-2-(azidomethyl)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromene is [N-]=[N+]=NC[C@H]1CCc2ccc(S(=O)(=O)c3cccc(F)c3)cc2O1.
What is the InChIKey of (2R)-2-(azidomethyl)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromene?
The InChIKey is NQYBACXPMIRWJU-CYBMUJFWSA-N. The full InChI is InChI=1S/C16H14FN3O3S/c17-12-2-1-3-14(8-12)24(21,22)15-7-5-11-4-6-13(10-19-20-18)23-16(11)9-15/h1-3,5,7-9,13H,4,6,10H2/t13-/m1/s1.
What are the key properties of (2R)-2-(azidomethyl)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromene?
(2R)-2-(azidomethyl)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromene has a molecular weight of 347.37 g/mol, XLogP of 3.66, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(azidomethyl)-7-(3-fluorophenyl)sulfonyl-3,4-dihydro-2H-chromene is sourced from PubChem (CID 58869127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).