About 2-ethyl-3-methoxy-6-methyl-1,2-dihydropyridine
2-ethyl-3-methoxy-6-methyl-1,2-dihydropyridine (PubChem CID 58869507) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 2-ethyl-3-methoxy-6-methyl-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2-ethyl-3-methoxy-6-methyl-1,2-dihydropyridine |
| PubChem CID | 58869507 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 2-ethyl-3-methoxy-6-methyl-1,2-dihydropyridine |
| SMILES | CCC1NC(C)=CC=C1OC |
| InChI | InChI=1S/C9H15NO/c1-4-8-9(11-3)6-5-7(2)10-8/h5-6,8,10H,4H2,1-3H3 |
| InChIKey | WHURJUDWIYXYQS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-3-methoxy-6-methyl-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-methoxy-6-methyl-1,2-dihydropyridine?
The IUPAC name of 2-ethyl-3-methoxy-6-methyl-1,2-dihydropyridine (CID 58869507) is 2-ethyl-3-methoxy-6-methyl-1,2-dihydropyridine.
What is the SMILES notation for 2-ethyl-3-methoxy-6-methyl-1,2-dihydropyridine?
The canonical SMILES for 2-ethyl-3-methoxy-6-methyl-1,2-dihydropyridine is CCC1NC(C)=CC=C1OC.
What is the InChIKey of 2-ethyl-3-methoxy-6-methyl-1,2-dihydropyridine?
The InChIKey is WHURJUDWIYXYQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-4-8-9(11-3)6-5-7(2)10-8/h5-6,8,10H,4H2,1-3H3.
What are the key properties of 2-ethyl-3-methoxy-6-methyl-1,2-dihydropyridine?
2-ethyl-3-methoxy-6-methyl-1,2-dihydropyridine has a molecular weight of 153.22 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-methoxy-6-methyl-1,2-dihydropyridine is sourced from PubChem (CID 58869507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).