C21H19Cl2F2N7O — CID 58869569
6-chloro-1-[2-[(5-chloro-2H-indazol-3-yl)methylamino]ethyl]-3-[(2,2-difluoro-2-pyridin-2-ylethyl)amino]pyrazin-2-one (PubChem CID 58869569) has the molecular formula C21H19Cl2F2N7O and a molecular weight of 494.33 g/mol. Its IUPAC name is 6-chloro-1-[2-[(5-chloro-2H-indazol-3-yl)methylamino]ethyl]-3-[(2,2-difluoro-2-pyridin-2-ylethyl)amino]pyrazin-2-one.
| Compound Name | 6-chloro-1-[2-[(5-chloro-2H-indazol-3-yl)methylamino]ethyl]-3-[(2,2-difluoro-2-pyridin-2-ylethyl)amino]pyrazin-2-one |
|---|---|
| PubChem CID | 58869569 |
| Molecular Formula | C21H19Cl2F2N7O |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 6-chloro-1-[2-[(5-chloro-2H-indazol-3-yl)methylamino]ethyl]-3-[(2,2-difluoro-2-pyridin-2-ylethyl)amino]pyrazin-2-one |
| SMILES | O=c1c(NCC(F)(F)c2ccccn2)ncc(Cl)n1CCNCc1[nH]nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C21H19Cl2F2N7O/c22-13-4-5-15-14(9-13)16(31-30-15)10-26-7-8-32-18(23)11-28-19(20(32)33)29-12-21(24,25)17-3-1-2-6-27-17/h1-6,9,11,26H,7-8,10,12H2,(H,28,29)(H,30,31) |
| InChIKey | GYDKMSMAMKDFRU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|