C21H19Cl2F2N7O2 — CID 58869597
6-chloro-1-[2-[(5-chloro-2H-indazol-3-yl)methylamino]ethyl]-3-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]pyrazin-2-one (PubChem CID 58869597) has the molecular formula C21H19Cl2F2N7O2 and a molecular weight of 510.33 g/mol. Its IUPAC name is 6-chloro-1-[2-[(5-chloro-2H-indazol-3-yl)methylamino]ethyl]-3-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]pyrazin-2-one.
| Compound Name | 6-chloro-1-[2-[(5-chloro-2H-indazol-3-yl)methylamino]ethyl]-3-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]pyrazin-2-one |
|---|---|
| PubChem CID | 58869597 |
| Molecular Formula | C21H19Cl2F2N7O2 |
| Molecular Weight | 510.33 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 6-chloro-1-[2-[(5-chloro-2H-indazol-3-yl)methylamino]ethyl]-3-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]pyrazin-2-one |
| SMILES | O=c1c(NCC(F)(F)c2cccc[n+]2[O-])ncc(Cl)n1CCNCc1[nH]nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C21H19Cl2F2N7O2/c22-13-4-5-15-14(9-13)16(30-29-15)10-26-6-8-31-18(23)11-27-19(20(31)33)28-12-21(24,25)17-3-1-2-7-32(17)34/h1-5,7,9,11,26H,6,8,10,12H2,(H,27,28)(H,29,30) |
| InChIKey | YCWXXAKDXMHOOA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 114.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|