C22H22ClF2N7O2 — CID 58869607
1-[2-[(5-chloro-2H-indazol-3-yl)methylamino]ethyl]-3-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]-6-methylpyrazin-2-one (PubChem CID 58869607) has the molecular formula C22H22ClF2N7O2 and a molecular weight of 489.91 g/mol. Its IUPAC name is 1-[2-[(5-chloro-2H-indazol-3-yl)methylamino]ethyl]-3-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]-6-methylpyrazin-2-one.
| Compound Name | 1-[2-[(5-chloro-2H-indazol-3-yl)methylamino]ethyl]-3-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]-6-methylpyrazin-2-one |
|---|---|
| PubChem CID | 58869607 |
| Molecular Formula | C22H22ClF2N7O2 |
| Molecular Weight | 489.91 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 1-[2-[(5-chloro-2H-indazol-3-yl)methylamino]ethyl]-3-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]-6-methylpyrazin-2-one |
| SMILES | Cc1cnc(NCC(F)(F)c2cccc[n+]2[O-])c(=O)n1CCNCc1[nH]nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C22H22ClF2N7O2/c1-14-11-27-20(28-13-22(24,25)19-4-2-3-8-32(19)34)21(33)31(14)9-7-26-12-18-16-10-15(23)5-6-17(16)29-30-18/h2-6,8,10-11,26H,7,9,12-13H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | PBPQFIISEZHXHQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 114.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.91 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|