C24H33N3 — CID 58869999
(4S)-1-N,1-N-diethyl-4-N-(2-tritioacridin-9-yl)heptane-1,4-diamine (PubChem CID 58869999) has the molecular formula C24H33N3 and a molecular weight of 365.56 g/mol. Its IUPAC name is (4S)-1-N,1-N-diethyl-4-N-(2-tritioacridin-9-yl)heptane-1,4-diamine.
| Compound Name | (4S)-1-N,1-N-diethyl-4-N-(2-tritioacridin-9-yl)heptane-1,4-diamine |
|---|---|
| PubChem CID | 58869999 |
| Molecular Formula | C24H33N3 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | (4S)-1-N,1-N-diethyl-4-N-(2-tritioacridin-9-yl)heptane-1,4-diamine |
| SMILES | [3H]c1ccc2nc3ccccc3c(N[C@@H](CCC)CCCN(CC)CC)c2c1 |
| InChI | InChI=1S/C24H33N3/c1-4-12-19(13-11-18-27(5-2)6-3)25-24-20-14-7-9-16-22(20)26-23-17-10-8-15-21(23)24/h7-10,14-17,19H,4-6,11-13,18H2,1-3H3,(H,25,26)/t19-/m0/s1/i7T |
| InChIKey | GFHOQRLLLDDZLJ-VHEJOCRMSA-N |
| XLogP | 6.09 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|