About 4-[(Z)-2-(2,6-dimethylphenyl)ethenyl]quinoline
4-[(Z)-2-(2,6-dimethylphenyl)ethenyl]quinoline (PubChem CID 58870156) has the molecular formula C19H17N
and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-[(Z)-2-(2,6-dimethylphenyl)ethenyl]quinoline.
Molecular Properties
| Compound Name | 4-[(Z)-2-(2,6-dimethylphenyl)ethenyl]quinoline |
| PubChem CID | 58870156 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 4-[(Z)-2-(2,6-dimethylphenyl)ethenyl]quinoline |
| SMILES | Cc1cccc(C)c1/C=C\c1ccnc2ccccc12 |
| InChI | InChI=1S/C19H17N/c1-14-6-5-7-15(2)17(14)11-10-16-12-13-20-19-9-4-3-8-18(16)19/h3-13H,1-2H3/b11-10- |
| InChIKey | CDZOGGXENXPDBM-KHPPLWFESA-N |
| XLogP | 5.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(Z)-2-(2,6-dimethylphenyl)ethenyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-2-(2,6-dimethylphenyl)ethenyl]quinoline?
The IUPAC name of 4-[(Z)-2-(2,6-dimethylphenyl)ethenyl]quinoline (CID 58870156) is 4-[(Z)-2-(2,6-dimethylphenyl)ethenyl]quinoline.
What is the SMILES notation for 4-[(Z)-2-(2,6-dimethylphenyl)ethenyl]quinoline?
The canonical SMILES for 4-[(Z)-2-(2,6-dimethylphenyl)ethenyl]quinoline is Cc1cccc(C)c1/C=C\c1ccnc2ccccc12.
What is the InChIKey of 4-[(Z)-2-(2,6-dimethylphenyl)ethenyl]quinoline?
The InChIKey is CDZOGGXENXPDBM-KHPPLWFESA-N. The full InChI is InChI=1S/C19H17N/c1-14-6-5-7-15(2)17(14)11-10-16-12-13-20-19-9-4-3-8-18(16)19/h3-13H,1-2H3/b11-10-.
What are the key properties of 4-[(Z)-2-(2,6-dimethylphenyl)ethenyl]quinoline?
4-[(Z)-2-(2,6-dimethylphenyl)ethenyl]quinoline has a molecular weight of 259.35 g/mol, XLogP of 5.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-2-(2,6-dimethylphenyl)ethenyl]quinoline is sourced from PubChem (CID 58870156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).