C15H20N2O4S — CID 58870347
5-[[4-methoxy-3-[3-(methylamino)propoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 58870347) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is 5-[[4-methoxy-3-[3-(methylamino)propoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-methoxy-3-[3-(methylamino)propoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58870347 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 5-[[4-methoxy-3-[3-(methylamino)propoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CNCCCOc1cc(CC2SC(=O)NC2=O)ccc1OC |
| InChI | InChI=1S/C15H20N2O4S/c1-16-6-3-7-21-12-8-10(4-5-11(12)20-2)9-13-14(18)17-15(19)22-13/h4-5,8,13,16H,3,6-7,9H2,1-2H3,(H,17,18,19) |
| InChIKey | VDHFGASNXHEHNG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|