About 2-(1H-indol-3-yl)ethyl acetate
2-(1H-indol-3-yl)ethyl acetate (PubChem CID 588705) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)ethyl acetate.
Molecular Properties
| Compound Name | 2-(1H-indol-3-yl)ethyl acetate |
| PubChem CID | 588705 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 2-(1H-indol-3-yl)ethyl acetate |
| SMILES | CC(=O)OCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H13NO2/c1-9(14)15-7-6-10-8-13-12-5-3-2-4-11(10)12/h2-5,8,13H,6-7H2,1H3 |
| InChIKey | KAWBLROQFPLJEU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1H-indol-3-yl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indol-3-yl)ethyl acetate?
The IUPAC name of 2-(1H-indol-3-yl)ethyl acetate (CID 588705) is 2-(1H-indol-3-yl)ethyl acetate.
What is the SMILES notation for 2-(1H-indol-3-yl)ethyl acetate?
The canonical SMILES for 2-(1H-indol-3-yl)ethyl acetate is CC(=O)OCCc1c[nH]c2ccccc12.
What is the InChIKey of 2-(1H-indol-3-yl)ethyl acetate?
The InChIKey is KAWBLROQFPLJEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-9(14)15-7-6-10-8-13-12-5-3-2-4-11(10)12/h2-5,8,13H,6-7H2,1H3.
What are the key properties of 2-(1H-indol-3-yl)ethyl acetate?
2-(1H-indol-3-yl)ethyl acetate has a molecular weight of 203.24 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indol-3-yl)ethyl acetate is sourced from PubChem (CID 588705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).