C13H20F2O6S — CID 58870521
(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)methyl 2,2-difluoro-2-(trioxidanylsulfanyl)acetate (PubChem CID 58870521) has the molecular formula C13H20F2O6S and a molecular weight of 342.36 g/mol. Its IUPAC name is (3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)methyl 2,2-difluoro-2-(trioxidanylsulfanyl)acetate.
| Compound Name | (3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)methyl 2,2-difluoro-2-(trioxidanylsulfanyl)acetate |
|---|---|
| PubChem CID | 58870521 |
| Molecular Formula | C13H20F2O6S |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)methyl 2,2-difluoro-2-(trioxidanylsulfanyl)acetate |
| SMILES | CC1(C)C2CCC1(C)C(O)C2COC(=O)C(F)(F)SOOO |
| InChI | InChI=1S/C13H20F2O6S/c1-11(2)8-4-5-12(11,3)9(16)7(8)6-19-10(17)13(14,15)22-21-20-18/h7-9,16,18H,4-6H2,1-3H3 |
| InChIKey | MNXJFXRXKWDSLU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|