C25H33FN4O4S — CID 58870739
ethyl 2-[4-[4-(1,1-dioxo-5-propyl-1,2,5-thiadiazolidin-2-yl)-2-fluorophenyl]piperazin-1-yl]-2-phenylacetate (PubChem CID 58870739) has the molecular formula C25H33FN4O4S and a molecular weight of 504.63 g/mol. Its IUPAC name is ethyl 2-[4-[4-(1,1-dioxo-5-propyl-1,2,5-thiadiazolidin-2-yl)-2-fluorophenyl]piperazin-1-yl]-2-phenylacetate.
| Compound Name | ethyl 2-[4-[4-(1,1-dioxo-5-propyl-1,2,5-thiadiazolidin-2-yl)-2-fluorophenyl]piperazin-1-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 58870739 |
| Molecular Formula | C25H33FN4O4S |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | ethyl 2-[4-[4-(1,1-dioxo-5-propyl-1,2,5-thiadiazolidin-2-yl)-2-fluorophenyl]piperazin-1-yl]-2-phenylacetate |
| SMILES | CCCN1CCN(c2ccc(N3CCN(C(C(=O)OCC)c4ccccc4)CC3)c(F)c2)S1(=O)=O |
| InChI | InChI=1S/C25H33FN4O4S/c1-3-12-29-17-18-30(35(29,32)33)21-10-11-23(22(26)19-21)27-13-15-28(16-14-27)24(25(31)34-4-2)20-8-6-5-7-9-20/h5-11,19,24H,3-4,12-18H2,1-2H3 |
| InChIKey | QGARKXQQTFQUCA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|