C22H14N2OPt — CID 58871074
platinum(2+);2-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)benzene-2-id-1-yl]oxypyridine (PubChem CID 58871074) has the molecular formula C22H14N2OPt and a molecular weight of 517.45 g/mol. Its IUPAC name is platinum(2+);2-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)benzene-2-id-1-yl]oxypyridine.
| Compound Name | platinum(2+);2-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)benzene-2-id-1-yl]oxypyridine |
|---|---|
| PubChem CID | 58871074 |
| Molecular Formula | C22H14N2OPt |
| Molecular Weight | 517.45 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | platinum(2+);2-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)benzene-2-id-1-yl]oxypyridine |
| SMILES | [Pt+2].[c-]1c(Oc2ccccn2)cccc1-c1[c-]c(-c2ccccn2)ccc1 |
| InChI | InChI=1S/C22H14N2O.Pt/c1-3-13-23-21(11-1)19-9-5-7-17(15-19)18-8-6-10-20(16-18)25-22-12-2-4-14-24-22;/h1-14H;/q-2;+2 |
| InChIKey | BJECJOWCMCLNQX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|