C19H19NO — CID 58871166
6-methoxy-2-(2,3,5-trimethylphenyl)quinoline (PubChem CID 58871166) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is 6-methoxy-2-(2,3,5-trimethylphenyl)quinoline.
| Compound Name | 6-methoxy-2-(2,3,5-trimethylphenyl)quinoline |
|---|---|
| PubChem CID | 58871166 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 6-methoxy-2-(2,3,5-trimethylphenyl)quinoline |
| SMILES | COc1ccc2nc(-c3cc(C)cc(C)c3C)ccc2c1 |
| InChI | InChI=1S/C19H19NO/c1-12-9-13(2)14(3)17(10-12)19-7-5-15-11-16(21-4)6-8-18(15)20-19/h5-11H,1-4H3 |
| InChIKey | MRLGEJRSGNWNNH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |