C28H38IrNO2- — CID 58871248
2-(2,5-dimethylbenzene-6-id-1-yl)-3,5,7-trimethylquinoline;5,5-dimethylhexane-2,4-diol;iridium (PubChem CID 58871248) has the molecular formula C28H38IrNO2- and a molecular weight of 612.83 g/mol. Its IUPAC name is 2-(2,5-dimethylbenzene-6-id-1-yl)-3,5,7-trimethylquinoline;5,5-dimethylhexane-2,4-diol;iridium.
| Compound Name | 2-(2,5-dimethylbenzene-6-id-1-yl)-3,5,7-trimethylquinoline;5,5-dimethylhexane-2,4-diol;iridium |
|---|---|
| PubChem CID | 58871248 |
| Molecular Formula | C28H38IrNO2- |
| Molecular Weight | 612.83 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | 2-(2,5-dimethylbenzene-6-id-1-yl)-3,5,7-trimethylquinoline;5,5-dimethylhexane-2,4-diol;iridium |
| SMILES | CC(O)CC(O)C(C)(C)C.Cc1[c-]c(-c2nc3cc(C)cc(C)c3cc2C)c(C)cc1.[Ir] |
| InChI | InChI=1S/C20H20N.C8H18O2.Ir/c1-12-6-7-14(3)18(9-12)20-16(5)11-17-15(4)8-13(2)10-19(17)21-20;1-6(9)5-7(10)8(2,3)4;/h6-8,10-11H,1-5H3;6-7,9-10H,5H2,1-4H3;/q-1;; |
| InChIKey | VNIBIVBBLOGNJJ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.83 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|