About 2-(3,4-dimethylphenyl)-3,7-dimethylquinoline
2-(3,4-dimethylphenyl)-3,7-dimethylquinoline (PubChem CID 58871250) has the molecular formula C19H19N
and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-3,7-dimethylquinoline.
Molecular Properties
| Compound Name | 2-(3,4-dimethylphenyl)-3,7-dimethylquinoline |
| PubChem CID | 58871250 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-3,7-dimethylquinoline |
| SMILES | Cc1ccc2cc(C)c(-c3ccc(C)c(C)c3)nc2c1 |
| InChI | InChI=1S/C19H19N/c1-12-5-7-16-11-15(4)19(20-18(16)9-12)17-8-6-13(2)14(3)10-17/h5-11H,1-4H3 |
| InChIKey | XFVUDHZOFAAUQZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3,4-dimethylphenyl)-3,7-dimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethylphenyl)-3,7-dimethylquinoline?
The IUPAC name of 2-(3,4-dimethylphenyl)-3,7-dimethylquinoline (CID 58871250) is 2-(3,4-dimethylphenyl)-3,7-dimethylquinoline.
What is the SMILES notation for 2-(3,4-dimethylphenyl)-3,7-dimethylquinoline?
The canonical SMILES for 2-(3,4-dimethylphenyl)-3,7-dimethylquinoline is Cc1ccc2cc(C)c(-c3ccc(C)c(C)c3)nc2c1.
What is the InChIKey of 2-(3,4-dimethylphenyl)-3,7-dimethylquinoline?
The InChIKey is XFVUDHZOFAAUQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N/c1-12-5-7-16-11-15(4)19(20-18(16)9-12)17-8-6-13(2)14(3)10-17/h5-11H,1-4H3.
What are the key properties of 2-(3,4-dimethylphenyl)-3,7-dimethylquinoline?
2-(3,4-dimethylphenyl)-3,7-dimethylquinoline has a molecular weight of 261.37 g/mol, XLogP of 5.14, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylphenyl)-3,7-dimethylquinoline is sourced from PubChem (CID 58871250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).