About [4-(2,6-dimethyloct-7-en-2-yloxy)-2-hydroxy-4-oxobutan-2-yl]phosphonic acid
[4-(2,6-dimethyloct-7-en-2-yloxy)-2-hydroxy-4-oxobutan-2-yl]phosphonic acid (PubChem CID 58871406) has the molecular formula C14H27O6P
and a molecular weight of 322.34 g/mol. Its IUPAC name is [4-(2,6-dimethyloct-7-en-2-yloxy)-2-hydroxy-4-oxobutan-2-yl]phosphonic acid.
Molecular Properties
| Compound Name | [4-(2,6-dimethyloct-7-en-2-yloxy)-2-hydroxy-4-oxobutan-2-yl]phosphonic acid |
| PubChem CID | 58871406 |
| Molecular Formula | C14H27O6P |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [4-(2,6-dimethyloct-7-en-2-yloxy)-2-hydroxy-4-oxobutan-2-yl]phosphonic acid |
| SMILES | C=CC(C)CCCC(C)(C)OC(=O)CC(C)(O)P(=O)(O)O |
| InChI | InChI=1S/C14H27O6P/c1-6-11(2)8-7-9-13(3,4)20-12(15)10-14(5,16)21(17,18)19/h6,11,16H,1,7-10H2,2-5H3,(H2,17,18,19) |
| InChIKey | ZKVKBJBMTPWPAH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,6-dimethyloct-7-en-2-yloxy)-2-hydroxy-4-oxobutan-2-yl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,6-dimethyloct-7-en-2-yloxy)-2-hydroxy-4-oxobutan-2-yl]phosphonic acid?
The IUPAC name of [4-(2,6-dimethyloct-7-en-2-yloxy)-2-hydroxy-4-oxobutan-2-yl]phosphonic acid (CID 58871406) is [4-(2,6-dimethyloct-7-en-2-yloxy)-2-hydroxy-4-oxobutan-2-yl]phosphonic acid.
What is the SMILES notation for [4-(2,6-dimethyloct-7-en-2-yloxy)-2-hydroxy-4-oxobutan-2-yl]phosphonic acid?
The canonical SMILES for [4-(2,6-dimethyloct-7-en-2-yloxy)-2-hydroxy-4-oxobutan-2-yl]phosphonic acid is C=CC(C)CCCC(C)(C)OC(=O)CC(C)(O)P(=O)(O)O.
What is the InChIKey of [4-(2,6-dimethyloct-7-en-2-yloxy)-2-hydroxy-4-oxobutan-2-yl]phosphonic acid?
The InChIKey is ZKVKBJBMTPWPAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27O6P/c1-6-11(2)8-7-9-13(3,4)20-12(15)10-14(5,16)21(17,18)19/h6,11,16H,1,7-10H2,2-5H3,(H2,17,18,19).
What are the key properties of [4-(2,6-dimethyloct-7-en-2-yloxy)-2-hydroxy-4-oxobutan-2-yl]phosphonic acid?
[4-(2,6-dimethyloct-7-en-2-yloxy)-2-hydroxy-4-oxobutan-2-yl]phosphonic acid has a molecular weight of 322.34 g/mol, XLogP of 2.58, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,6-dimethyloct-7-en-2-yloxy)-2-hydroxy-4-oxobutan-2-yl]phosphonic acid is sourced from PubChem (CID 58871406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).