C19H31N3O2 — CID 58871541
2-[(3S,5R)-2-benzyl-5-methyl-5-[(E)-(methylhydrazinylidene)methyl]-3-(2-methylpropyl)-1,2-oxazolidin-3-yl]ethanol (PubChem CID 58871541) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-[(3S,5R)-2-benzyl-5-methyl-5-[(E)-(methylhydrazinylidene)methyl]-3-(2-methylpropyl)-1,2-oxazolidin-3-yl]ethanol.
| Compound Name | 2-[(3S,5R)-2-benzyl-5-methyl-5-[(E)-(methylhydrazinylidene)methyl]-3-(2-methylpropyl)-1,2-oxazolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 58871541 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 2-[(3S,5R)-2-benzyl-5-methyl-5-[(E)-(methylhydrazinylidene)methyl]-3-(2-methylpropyl)-1,2-oxazolidin-3-yl]ethanol |
| SMILES | CN/N=C/[C@@]1(C)C[C@@](CCO)(CC(C)C)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C19H31N3O2/c1-16(2)12-19(10-11-23)14-18(3,15-21-20-4)24-22(19)13-17-8-6-5-7-9-17/h5-9,15-16,20,23H,10-14H2,1-4H3/b21-15+/t18-,19-/m1/s1 |
| InChIKey | SARIFCXVAHYQAD-RLPGOOFBSA-N |
| XLogP | 2.96 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|