About magnesium;5-methyl-2H-pyridin-2-ide;chloride
magnesium;5-methyl-2H-pyridin-2-ide;chloride (PubChem CID 58872235) has the molecular formula C6H6ClMgN
and a molecular weight of 151.88 g/mol. Its IUPAC name is magnesium;5-methyl-2H-pyridin-2-ide;chloride.
Molecular Properties
| Compound Name | magnesium;5-methyl-2H-pyridin-2-ide;chloride |
| PubChem CID | 58872235 |
| Molecular Formula | C6H6ClMgN |
| Molecular Weight | 151.88 g/mol |
| Exact Mass | 151.00 |
| IUPAC Name | magnesium;5-methyl-2H-pyridin-2-ide;chloride |
| SMILES | Cc1cc[c-]nc1.[Cl-].[Mg+2] |
| InChI | InChI=1S/C6H6N.ClH.Mg/c1-6-3-2-4-7-5-6;;/h2-3,5H,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | LCLAVDUDDLUEBH-UHFFFAOYSA-M |
| XLogP | -2.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.88 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;5-methyl-2H-pyridin-2-ide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;5-methyl-2H-pyridin-2-ide;chloride?
The IUPAC name of magnesium;5-methyl-2H-pyridin-2-ide;chloride (CID 58872235) is magnesium;5-methyl-2H-pyridin-2-ide;chloride.
What is the SMILES notation for magnesium;5-methyl-2H-pyridin-2-ide;chloride?
The canonical SMILES for magnesium;5-methyl-2H-pyridin-2-ide;chloride is Cc1cc[c-]nc1.[Cl-].[Mg+2].
What is the InChIKey of magnesium;5-methyl-2H-pyridin-2-ide;chloride?
The InChIKey is LCLAVDUDDLUEBH-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6N.ClH.Mg/c1-6-3-2-4-7-5-6;;/h2-3,5H,1H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;5-methyl-2H-pyridin-2-ide;chloride?
magnesium;5-methyl-2H-pyridin-2-ide;chloride has a molecular weight of 151.88 g/mol, XLogP of -2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;5-methyl-2H-pyridin-2-ide;chloride is sourced from PubChem (CID 58872235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).