About (2S)-1,2-bis(but-2-ynoxy)butane
(2S)-1,2-bis(but-2-ynoxy)butane (PubChem CID 58872576) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is (2S)-1,2-bis(but-2-ynoxy)butane.
Molecular Properties
| Compound Name | (2S)-1,2-bis(but-2-ynoxy)butane |
| PubChem CID | 58872576 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (2S)-1,2-bis(but-2-ynoxy)butane |
| SMILES | CC#CCOC[C@H](CC)OCC#CC |
| InChI | InChI=1S/C12H18O2/c1-4-7-9-13-11-12(6-3)14-10-8-5-2/h12H,6,9-11H2,1-3H3/t12-/m0/s1 |
| InChIKey | AAUSOXIVGWYSBP-LBPRGKRZSA-N |
| XLogP | 1.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,2-bis(but-2-ynoxy)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,2-bis(but-2-ynoxy)butane?
The IUPAC name of (2S)-1,2-bis(but-2-ynoxy)butane (CID 58872576) is (2S)-1,2-bis(but-2-ynoxy)butane.
What is the SMILES notation for (2S)-1,2-bis(but-2-ynoxy)butane?
The canonical SMILES for (2S)-1,2-bis(but-2-ynoxy)butane is CC#CCOC[C@H](CC)OCC#CC.
What is the InChIKey of (2S)-1,2-bis(but-2-ynoxy)butane?
The InChIKey is AAUSOXIVGWYSBP-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H18O2/c1-4-7-9-13-11-12(6-3)14-10-8-5-2/h12H,6,9-11H2,1-3H3/t12-/m0/s1.
What are the key properties of (2S)-1,2-bis(but-2-ynoxy)butane?
(2S)-1,2-bis(but-2-ynoxy)butane has a molecular weight of 194.27 g/mol, XLogP of 1.84, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,2-bis(but-2-ynoxy)butane is sourced from PubChem (CID 58872576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).