C18H23N4O6SY- — CID 58872622
(6R,7R)-7-[[(2Z)-2-methoxyimino-3-oxobutanoyl]amino]-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;yttrium (PubChem CID 58872622) has the molecular formula C18H23N4O6SY- and a molecular weight of 512.38 g/mol. Its IUPAC name is (6R,7R)-7-[[(2Z)-2-methoxyimino-3-oxobutanoyl]amino]-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;yttrium.
| Compound Name | (6R,7R)-7-[[(2Z)-2-methoxyimino-3-oxobutanoyl]amino]-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;yttrium |
|---|---|
| PubChem CID | 58872622 |
| Molecular Formula | C18H23N4O6SY- |
| Molecular Weight | 512.38 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | (6R,7R)-7-[[(2Z)-2-methoxyimino-3-oxobutanoyl]amino]-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;yttrium |
| SMILES | [CH2-]C(=O)/C(=N/OC)C(=O)N[C@@H]1C(=O)N2C(C(=O)[O-])=C(C[N+]3(C)CCCC3)CS[C@H]12.[Y] |
| InChI | InChI=1S/C18H24N4O6S.Y/c1-10(23)12(20-28-3)15(24)19-13-16(25)21-14(18(26)27)11(9-29-17(13)21)8-22(2)6-4-5-7-22;/h13,17H,1,4-9H2,2-3H3,(H,19,24)(H,26,27);/p-1/b20-12-;/t13-,17-;/m1./s1 |
| InChIKey | POXVSDGKBUHQMP-OOOQTXDZSA-M |
| XLogP | -1.97 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.38 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|