C23H26N8OS — CID 58873955
N,N,3-trimethyl-5-[[3-(1-methylpyrazol-4-yl)-6-(1,2,3,6-tetrahydropyridin-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]thiophene-2-carboxamide (PubChem CID 58873955) has the molecular formula C23H26N8OS and a molecular weight of 462.58 g/mol. Its IUPAC name is N,N,3-trimethyl-5-[[3-(1-methylpyrazol-4-yl)-6-(1,2,3,6-tetrahydropyridin-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]thiophene-2-carboxamide.
| Compound Name | N,N,3-trimethyl-5-[[3-(1-methylpyrazol-4-yl)-6-(1,2,3,6-tetrahydropyridin-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 58873955 |
| Molecular Formula | C23H26N8OS |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | N,N,3-trimethyl-5-[[3-(1-methylpyrazol-4-yl)-6-(1,2,3,6-tetrahydropyridin-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]thiophene-2-carboxamide |
| SMILES | Cc1cc(Nc2nc(C3=CCCNC3)cn3c(-c4cnn(C)c4)cnc23)sc1C(=O)N(C)C |
| InChI | InChI=1S/C23H26N8OS/c1-14-8-19(33-20(14)23(32)29(2)3)28-21-22-25-11-18(16-10-26-30(4)12-16)31(22)13-17(27-21)15-6-5-7-24-9-15/h6,8,10-13,24H,5,7,9H2,1-4H3,(H,27,28) |
| InChIKey | VCJQWSHIXPDSQZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 92.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |