About 5-amino-N,N,3-trimethylthiophene-2-carboxamide
5-amino-N,N,3-trimethylthiophene-2-carboxamide (PubChem CID 58873994) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is 5-amino-N,N,3-trimethylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | 5-amino-N,N,3-trimethylthiophene-2-carboxamide |
| PubChem CID | 58873994 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 5-amino-N,N,3-trimethylthiophene-2-carboxamide |
| SMILES | Cc1cc(N)sc1C(=O)N(C)C |
| InChI | InChI=1S/C8H12N2OS/c1-5-4-6(9)12-7(5)8(11)10(2)3/h4H,9H2,1-3H3 |
| InChIKey | LDLOVMRDKTYBCY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-N,N,3-trimethylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N,N,3-trimethylthiophene-2-carboxamide?
The IUPAC name of 5-amino-N,N,3-trimethylthiophene-2-carboxamide (CID 58873994) is 5-amino-N,N,3-trimethylthiophene-2-carboxamide.
What is the SMILES notation for 5-amino-N,N,3-trimethylthiophene-2-carboxamide?
The canonical SMILES for 5-amino-N,N,3-trimethylthiophene-2-carboxamide is Cc1cc(N)sc1C(=O)N(C)C.
What is the InChIKey of 5-amino-N,N,3-trimethylthiophene-2-carboxamide?
The InChIKey is LDLOVMRDKTYBCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c1-5-4-6(9)12-7(5)8(11)10(2)3/h4H,9H2,1-3H3.
What are the key properties of 5-amino-N,N,3-trimethylthiophene-2-carboxamide?
5-amino-N,N,3-trimethylthiophene-2-carboxamide has a molecular weight of 184.26 g/mol, XLogP of 1.34, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N,N,3-trimethylthiophene-2-carboxamide is sourced from PubChem (CID 58873994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).