C13H18O5 — CID 58874364
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2,3,4-trimethylpent-2-enoate (PubChem CID 58874364) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2,3,4-trimethylpent-2-enoate.
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2,3,4-trimethylpent-2-enoate |
|---|---|
| PubChem CID | 58874364 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2,3,4-trimethylpent-2-enoate |
| SMILES | C/C(C(=O)OCc1oc(=O)oc1C)=C(/C)C(C)C |
| InChI | InChI=1S/C13H18O5/c1-7(2)8(3)9(4)12(14)16-6-11-10(5)17-13(15)18-11/h7H,6H2,1-5H3/b9-8+ |
| InChIKey | NDYZZEIRBBEZIC-CMDGGOBGSA-N |
| XLogP | 2.58 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|