About cis-(1S,2R)-4-ethoxycyclohexane-1,2-diamine
cis-(1S,2R)-4-ethoxycyclohexane-1,2-diamine (PubChem CID 58874408) has the molecular formula C8H18N2O
and a molecular weight of 158.24 g/mol. Its IUPAC name is cis-(1S,2R)-4-ethoxycyclohexane-1,2-diamine.
Molecular Properties
| Compound Name | cis-(1S,2R)-4-ethoxycyclohexane-1,2-diamine |
| PubChem CID | 58874408 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | cis-(1S,2R)-4-ethoxycyclohexane-1,2-diamine |
| SMILES | CCOC1CC[C@H](N)[C@H](N)C1 |
| InChI | InChI=1S/C8H18N2O/c1-2-11-6-3-4-7(9)8(10)5-6/h6-8H,2-5,9-10H2,1H3/t6?,7-,8+/m0/s1 |
| InChIKey | WYQKSIZGLHKUNY-ZHFSPANRSA-N |
| XLogP | 0.23 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(1S,2R)-4-ethoxycyclohexane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-4-ethoxycyclohexane-1,2-diamine?
The IUPAC name of cis-(1S,2R)-4-ethoxycyclohexane-1,2-diamine (CID 58874408) is cis-(1S,2R)-4-ethoxycyclohexane-1,2-diamine.
What is the SMILES notation for cis-(1S,2R)-4-ethoxycyclohexane-1,2-diamine?
The canonical SMILES for cis-(1S,2R)-4-ethoxycyclohexane-1,2-diamine is CCOC1CC[C@H](N)[C@H](N)C1.
What is the InChIKey of cis-(1S,2R)-4-ethoxycyclohexane-1,2-diamine?
The InChIKey is WYQKSIZGLHKUNY-ZHFSPANRSA-N. The full InChI is InChI=1S/C8H18N2O/c1-2-11-6-3-4-7(9)8(10)5-6/h6-8H,2-5,9-10H2,1H3/t6?,7-,8+/m0/s1.
What are the key properties of cis-(1S,2R)-4-ethoxycyclohexane-1,2-diamine?
cis-(1S,2R)-4-ethoxycyclohexane-1,2-diamine has a molecular weight of 158.24 g/mol, XLogP of 0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-4-ethoxycyclohexane-1,2-diamine is sourced from PubChem (CID 58874408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).