About tert-butyl 2-(2-acetyl-4,4-dimethyl-5-oxooxolan-3-yl)acetate
tert-butyl 2-(2-acetyl-4,4-dimethyl-5-oxooxolan-3-yl)acetate (PubChem CID 58875382) has the molecular formula C14H22O5
and a molecular weight of 270.32 g/mol. Its IUPAC name is tert-butyl 2-(2-acetyl-4,4-dimethyl-5-oxooxolan-3-yl)acetate.
Molecular Properties
| Compound Name | tert-butyl 2-(2-acetyl-4,4-dimethyl-5-oxooxolan-3-yl)acetate |
| PubChem CID | 58875382 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | tert-butyl 2-(2-acetyl-4,4-dimethyl-5-oxooxolan-3-yl)acetate |
| SMILES | CC(=O)C1OC(=O)C(C)(C)C1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22O5/c1-8(15)11-9(14(5,6)12(17)18-11)7-10(16)19-13(2,3)4/h9,11H,7H2,1-6H3 |
| InChIKey | XHZDCEYYMXSECS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-(2-acetyl-4,4-dimethyl-5-oxooxolan-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(2-acetyl-4,4-dimethyl-5-oxooxolan-3-yl)acetate?
The IUPAC name of tert-butyl 2-(2-acetyl-4,4-dimethyl-5-oxooxolan-3-yl)acetate (CID 58875382) is tert-butyl 2-(2-acetyl-4,4-dimethyl-5-oxooxolan-3-yl)acetate.
What is the SMILES notation for tert-butyl 2-(2-acetyl-4,4-dimethyl-5-oxooxolan-3-yl)acetate?
The canonical SMILES for tert-butyl 2-(2-acetyl-4,4-dimethyl-5-oxooxolan-3-yl)acetate is CC(=O)C1OC(=O)C(C)(C)C1CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-(2-acetyl-4,4-dimethyl-5-oxooxolan-3-yl)acetate?
The InChIKey is XHZDCEYYMXSECS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O5/c1-8(15)11-9(14(5,6)12(17)18-11)7-10(16)19-13(2,3)4/h9,11H,7H2,1-6H3.
What are the key properties of tert-butyl 2-(2-acetyl-4,4-dimethyl-5-oxooxolan-3-yl)acetate?
tert-butyl 2-(2-acetyl-4,4-dimethyl-5-oxooxolan-3-yl)acetate has a molecular weight of 270.32 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(2-acetyl-4,4-dimethyl-5-oxooxolan-3-yl)acetate is sourced from PubChem (CID 58875382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).