About 1-(2,3-dihydroxypropyl)-3-propan-2-ylurea
1-(2,3-dihydroxypropyl)-3-propan-2-ylurea (PubChem CID 58875833) has the molecular formula C7H16N2O3
and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)-3-propan-2-ylurea.
Molecular Properties
| Compound Name | 1-(2,3-dihydroxypropyl)-3-propan-2-ylurea |
| PubChem CID | 58875833 |
| Molecular Formula | C7H16N2O3 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NCC(O)CO |
| InChI | InChI=1S/C7H16N2O3/c1-5(2)9-7(12)8-3-6(11)4-10/h5-6,10-11H,3-4H2,1-2H3,(H2,8,9,12) |
| InChIKey | QRPLMURYKLIHKA-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,3-dihydroxypropyl)-3-propan-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydroxypropyl)-3-propan-2-ylurea?
The IUPAC name of 1-(2,3-dihydroxypropyl)-3-propan-2-ylurea (CID 58875833) is 1-(2,3-dihydroxypropyl)-3-propan-2-ylurea.
What is the SMILES notation for 1-(2,3-dihydroxypropyl)-3-propan-2-ylurea?
The canonical SMILES for 1-(2,3-dihydroxypropyl)-3-propan-2-ylurea is CC(C)NC(=O)NCC(O)CO.
What is the InChIKey of 1-(2,3-dihydroxypropyl)-3-propan-2-ylurea?
The InChIKey is QRPLMURYKLIHKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O3/c1-5(2)9-7(12)8-3-6(11)4-10/h5-6,10-11H,3-4H2,1-2H3,(H2,8,9,12).
What are the key properties of 1-(2,3-dihydroxypropyl)-3-propan-2-ylurea?
1-(2,3-dihydroxypropyl)-3-propan-2-ylurea has a molecular weight of 176.22 g/mol, XLogP of -0.95, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydroxypropyl)-3-propan-2-ylurea is sourced from PubChem (CID 58875833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).