C35H26BF12IrN5 — CID 58875963
bis[3,5-bis(trifluoromethyl)phenyl]-bis(3-methyl-2H-imidazol-2-ylium-1-yl)boranuide;iridium;2-phenylpyridine (PubChem CID 58875963) has the molecular formula C35H26BF12IrN5 and a molecular weight of 947.63 g/mol. Its IUPAC name is bis[3,5-bis(trifluoromethyl)phenyl]-bis(3-methyl-2H-imidazol-2-ylium-1-yl)boranuide;iridium;2-phenylpyridine.
| Compound Name | bis[3,5-bis(trifluoromethyl)phenyl]-bis(3-methyl-2H-imidazol-2-ylium-1-yl)boranuide;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 58875963 |
| Molecular Formula | C35H26BF12IrN5 |
| Molecular Weight | 947.63 g/mol |
| Exact Mass | 948.17 |
| IUPAC Name | bis[3,5-bis(trifluoromethyl)phenyl]-bis(3-methyl-2H-imidazol-2-ylium-1-yl)boranuide;iridium;2-phenylpyridine |
| SMILES | Cn1ccn([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n2ccn(C)[cH+]2)[cH+]1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C24H18BF12N4.C11H8N.Ir/c1-38-3-5-40(13-38)25(41-6-4-39(2)14-41,19-9-15(21(26,27)28)7-16(10-19)22(29,30)31)20-11-17(23(32,33)34)8-18(12-20)24(35,36)37;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3-14H,1-2H3;1-6,8-9H;/q+1;-1; |
| InChIKey | NXIJPNYINVVOOO-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 32.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.63 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|