C34H23BF12IrN5- — CID 58875981
bis[3,5-bis(trifluoromethyl)phenyl]-(3-methyl-2H-imidazol-2-ylium-1-yl)-pyrazol-1-ylboranuide;iridium;2-phenylpyridine (PubChem CID 58875981) has the molecular formula C34H23BF12IrN5- and a molecular weight of 932.60 g/mol. Its IUPAC name is bis[3,5-bis(trifluoromethyl)phenyl]-(3-methyl-2H-imidazol-2-ylium-1-yl)-pyrazol-1-ylboranuide;iridium;2-phenylpyridine.
| Compound Name | bis[3,5-bis(trifluoromethyl)phenyl]-(3-methyl-2H-imidazol-2-ylium-1-yl)-pyrazol-1-ylboranuide;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 58875981 |
| Molecular Formula | C34H23BF12IrN5- |
| Molecular Weight | 932.60 g/mol |
| Exact Mass | 933.15 |
| IUPAC Name | bis[3,5-bis(trifluoromethyl)phenyl]-(3-methyl-2H-imidazol-2-ylium-1-yl)-pyrazol-1-ylboranuide;iridium;2-phenylpyridine |
| SMILES | Cn1ccn([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n2cccn2)[cH+]1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C23H15BF12N4.C11H8N.Ir/c1-38-5-6-39(13-38)24(40-4-2-3-37-40,18-9-14(20(25,26)27)7-15(10-18)21(28,29)30)19-11-16(22(31,32)33)8-17(12-19)23(34,35)36;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-13H,1H3;1-6,8-9H;/q;-1; |
| InChIKey | YNAHSJGFLKKPJY-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 40.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.60 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|