C26H16N2O4S4 — CID 58876463
2-[4,10-bis(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]-2-isocyanoacetonitrile (PubChem CID 58876463) has the molecular formula C26H16N2O4S4 and a molecular weight of 548.69 g/mol. Its IUPAC name is 2-[4,10-bis(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[4,10-bis(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 58876463 |
| Molecular Formula | C26H16N2O4S4 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.00 |
| IUPAC Name | 2-[4,10-bis(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1c2cc(-c3sc(C)c4c3OCCO4)sc2-c2sc(-c3sc(C)c4c3OCCO4)cc21 |
| InChI | InChI=1S/C26H16N2O4S4/c1-11-19-21(31-6-4-29-19)25(33-11)16-8-13-18(15(10-27)28-3)14-9-17(36-24(14)23(13)35-16)26-22-20(12(2)34-26)30-5-7-32-22/h8-9H,4-7H2,1-2H3 |
| InChIKey | AETBCWOSDFTBPN-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|