C42H38 — CID 58876629
2-[bis[4-[(1E,3E)-4-phenylbuta-1,3-dienyl]phenyl]methyl]-1-ethyl-3-methylbenzene (PubChem CID 58876629) has the molecular formula C42H38 and a molecular weight of 542.77 g/mol. Its IUPAC name is 2-[bis[4-[(1E,3E)-4-phenylbuta-1,3-dienyl]phenyl]methyl]-1-ethyl-3-methylbenzene.
| Compound Name | 2-[bis[4-[(1E,3E)-4-phenylbuta-1,3-dienyl]phenyl]methyl]-1-ethyl-3-methylbenzene |
|---|---|
| PubChem CID | 58876629 |
| Molecular Formula | C42H38 |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | 2-[bis[4-[(1E,3E)-4-phenylbuta-1,3-dienyl]phenyl]methyl]-1-ethyl-3-methylbenzene |
| SMILES | CCc1cccc(C)c1C(c1ccc(/C=C/C=C/c2ccccc2)cc1)c1ccc(/C=C/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C42H38/c1-3-38-24-14-15-33(2)41(38)42(39-29-25-36(26-30-39)22-12-10-20-34-16-6-4-7-17-34)40-31-27-37(28-32-40)23-13-11-21-35-18-8-5-9-19-35/h4-32,42H,3H2,1-2H3/b20-10+,21-11+,22-12+,23-13+ |
| InChIKey | KOJRMOWZMQLRQX-GADKKREASA-N |
| XLogP | 11.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|