C23H20ClFN10O — CID 58876778
N-[(E)-[5-[3-chloro-5-(1,3,5-triazin-2-yl)anilino]-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 58876778) has the molecular formula C23H20ClFN10O and a molecular weight of 506.93 g/mol. Its IUPAC name is N-[(E)-[5-[3-chloro-5-(1,3,5-triazin-2-yl)anilino]-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | N-[(E)-[5-[3-chloro-5-(1,3,5-triazin-2-yl)anilino]-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 58876778 |
| Molecular Formula | C23H20ClFN10O |
| Molecular Weight | 506.93 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | N-[(E)-[5-[3-chloro-5-(1,3,5-triazin-2-yl)anilino]-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | Fc1cnc(N/N=C/c2ccc(Nc3cc(Cl)cc(-c4ncncn4)c3)cn2)nc1N1CCOCC1 |
| InChI | InChI=1S/C23H20ClFN10O/c24-16-7-15(21-29-13-26-14-30-21)8-19(9-16)32-18-2-1-17(27-10-18)11-31-34-23-28-12-20(25)22(33-23)35-3-5-36-6-4-35/h1-2,7-14,32H,3-6H2,(H,28,33,34)/b31-11+ |
| InChIKey | ARPXVLSFJCBNIB-QFDQHJFZSA-N |
| XLogP | 3.54 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.93 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|