C29H28ClFN6O3 — CID 58876917
5-chloro-2-ethyl-N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-4-[3-(3-hydroxyphenyl)anilino]benzohydrazide (PubChem CID 58876917) has the molecular formula C29H28ClFN6O3 and a molecular weight of 563.03 g/mol. Its IUPAC name is 5-chloro-2-ethyl-N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-4-[3-(3-hydroxyphenyl)anilino]benzohydrazide.
| Compound Name | 5-chloro-2-ethyl-N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-4-[3-(3-hydroxyphenyl)anilino]benzohydrazide |
|---|---|
| PubChem CID | 58876917 |
| Molecular Formula | C29H28ClFN6O3 |
| Molecular Weight | 563.03 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | 5-chloro-2-ethyl-N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-4-[3-(3-hydroxyphenyl)anilino]benzohydrazide |
| SMILES | CCc1cc(Nc2cccc(-c3cccc(O)c3)c2)c(Cl)cc1C(=O)NNc1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C29H28ClFN6O3/c1-2-18-15-26(33-21-7-3-5-19(13-21)20-6-4-8-22(38)14-20)24(30)16-23(18)28(39)35-36-29-32-17-25(31)27(34-29)37-9-11-40-12-10-37/h3-8,13-17,33,38H,2,9-12H2,1H3,(H,35,39)(H,32,34,36) |
| InChIKey | HMPNQXLOVXIUKF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.03 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|