C24H22FN9O2 — CID 58876963
N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-(3-pyrimidin-5-ylanilino)pyridine-2-carbohydrazide (PubChem CID 58876963) has the molecular formula C24H22FN9O2 and a molecular weight of 487.50 g/mol. Its IUPAC name is N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-(3-pyrimidin-5-ylanilino)pyridine-2-carbohydrazide.
| Compound Name | N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-(3-pyrimidin-5-ylanilino)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 58876963 |
| Molecular Formula | C24H22FN9O2 |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-(3-pyrimidin-5-ylanilino)pyridine-2-carbohydrazide |
| SMILES | O=C(NNc1ncc(F)c(N2CCOCC2)n1)c1ccc(Nc2cccc(-c3cncnc3)c2)cn1 |
| InChI | InChI=1S/C24H22FN9O2/c25-20-14-29-24(31-22(20)34-6-8-36-9-7-34)33-32-23(35)21-5-4-19(13-28-21)30-18-3-1-2-16(10-18)17-11-26-15-27-12-17/h1-5,10-15,30H,6-9H2,(H,32,35)(H,29,31,33) |
| InChIKey | RGHFVVIDJMARIO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|