C25H21F4N9O2 — CID 58876965
N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-[3-pyrimidin-5-yl-5-(trifluoromethyl)anilino]pyridine-2-carbohydrazide (PubChem CID 58876965) has the molecular formula C25H21F4N9O2 and a molecular weight of 555.50 g/mol. Its IUPAC name is N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-[3-pyrimidin-5-yl-5-(trifluoromethyl)anilino]pyridine-2-carbohydrazide.
| Compound Name | N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-[3-pyrimidin-5-yl-5-(trifluoromethyl)anilino]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 58876965 |
| Molecular Formula | C25H21F4N9O2 |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | N'-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-[3-pyrimidin-5-yl-5-(trifluoromethyl)anilino]pyridine-2-carbohydrazide |
| SMILES | O=C(NNc1ncc(F)c(N2CCOCC2)n1)c1ccc(Nc2cc(-c3cncnc3)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C25H21F4N9O2/c26-20-13-33-24(35-22(20)38-3-5-40-6-4-38)37-36-23(39)21-2-1-18(12-32-21)34-19-8-15(16-10-30-14-31-11-16)7-17(9-19)25(27,28)29/h1-2,7-14,34H,3-6H2,(H,36,39)(H,33,35,37) |
| InChIKey | SZDKLLUNTVAWPA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|