C27H34ClFN8O2 — CID 58877088
2-chloro-6-[[2-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinyl]methyl]-4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]phenol (PubChem CID 58877088) has the molecular formula C27H34ClFN8O2 and a molecular weight of 557.07 g/mol. Its IUPAC name is 2-chloro-6-[[2-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinyl]methyl]-4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]phenol.
| Compound Name | 2-chloro-6-[[2-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinyl]methyl]-4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]phenol |
|---|---|
| PubChem CID | 58877088 |
| Molecular Formula | C27H34ClFN8O2 |
| Molecular Weight | 557.07 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 2-chloro-6-[[2-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinyl]methyl]-4-[4-[(4-methylpiperazin-1-yl)methyl]anilino]phenol |
| SMILES | CN1CCN(Cc2ccc(Nc3cc(Cl)c(O)c(CNNc4ncc(F)c(N5CCOCC5)n4)c3)cc2)CC1 |
| InChI | InChI=1S/C27H34ClFN8O2/c1-35-6-8-36(9-7-35)18-19-2-4-21(5-3-19)32-22-14-20(25(38)23(28)15-22)16-31-34-27-30-17-24(29)26(33-27)37-10-12-39-13-11-37/h2-5,14-15,17,31-32,38H,6-13,16,18H2,1H3,(H,30,33,34) |
| InChIKey | PTYLMJVFLBLOAG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.07 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|